C39H47N2P2Si2Sm- — CID 11308850
CID 11308850 (PubChem CID 11308850) has the molecular formula C39H47N2P2Si2Sm- and a molecular weight of 812.30 g/mol.
| Compound Name | CID 11308850 |
|---|---|
| PubChem CID | 11308850 |
| Molecular Formula | C39H47N2P2Si2Sm- |
| Molecular Weight | 812.30 g/mol |
| Exact Mass | 813.20 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)N=P(C=P([N-][Si](C)(C)C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH][CH][CH][CH]1.[Sm] |
| InChI | InChI=1S/C31H39N2P2Si2.C8H8.Sm/c1-36(2,3)32-34(28-19-11-7-12-20-28,29-21-13-8-14-22-29)27-35(33-37(4,5)6,30-23-15-9-16-24-30)31-25-17-10-18-26-31;1-2-4-6-8-7-5-3-1;/h7-27H,1-6H3;1-8H;/q-1;; |
| InChIKey | PROBWNNJQMHHGD-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.30 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|