C19H31N2PSi2Ti — CID 20675229
carbanide;[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-trimethylsilylazanide;titanium(2+) (PubChem CID 20675229) has the molecular formula C19H31N2PSi2Ti and a molecular weight of 422.48 g/mol. Its IUPAC name is carbanide;[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-trimethylsilylazanide;titanium(2+).
| Compound Name | carbanide;[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-trimethylsilylazanide;titanium(2+) |
|---|---|
| PubChem CID | 20675229 |
| Molecular Formula | C19H31N2PSi2Ti |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | carbanide;[diphenyl(trimethylsilylimino)-λ5-phosphanyl]-trimethylsilylazanide;titanium(2+) |
| SMILES | C[Si](C)(C)N=P([N-][Si](C)(C)C)(c1ccccc1)c1ccccc1.[CH3-].[Ti+2] |
| InChI | InChI=1S/C18H28N2PSi2.CH3.Ti/c1-22(2,3)19-21(20-23(4,5)6,17-13-9-7-10-14-17)18-15-11-8-12-16-18;;/h7-16H,1-6H3;1H3;/q2*-1;+2 |
| InChIKey | DZWSZYWXAKJTSF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|