C19H30O4 — CID 102398053
(1R,2R,3R,4S)-3-[3-(2,2-dimethylpropanoyloxy)propyl]-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 102398053) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-[3-(2,2-dimethylpropanoyloxy)propyl]-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4S)-3-[3-(2,2-dimethylpropanoyloxy)propyl]-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 102398053 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (1R,2R,3R,4S)-3-[3-(2,2-dimethylpropanoyloxy)propyl]-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | CC(C)(C)C(=O)OCCC[C@@H]1[C@@H](C(=O)O)[C@@]2(C)C=C[C@]1(C)CC2 |
| InChI | InChI=1S/C19H30O4/c1-17(2,3)16(22)23-12-6-7-13-14(15(20)21)19(5)10-8-18(13,4)9-11-19/h8,10,13-14H,6-7,9,11-12H2,1-5H3,(H,20,21)/t13-,14+,18-,19+/m1/s1 |
| InChIKey | XOTCNFCOZBLARG-CFGMGRTJSA-N |
| XLogP | 4.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|