C5H10O3 — CID 102400403
(E)-3-methylbut-3-ene-1,2,4-triol (PubChem CID 102400403) has the molecular formula C5H10O3 and a molecular weight of 118.13 g/mol. Its IUPAC name is (E)-3-methylbut-3-ene-1,2,4-triol.
| Compound Name | (E)-3-methylbut-3-ene-1,2,4-triol |
|---|---|
| PubChem CID | 102400403 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (E)-3-methylbut-3-ene-1,2,4-triol |
| SMILES | C/C(=C\O)C(O)CO |
| InChI | InChI=1S/C5H10O3/c1-4(2-6)5(8)3-7/h2,5-8H,3H2,1H3/b4-2+ |
| InChIKey | FVYHKVMWBMOFGS-DUXPYHPUSA-N |
| XLogP | -0.20 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|