C21H18BrNO2 — CID 102401747
ethyl 18-bromo-3-methyl-2-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),3,5,8,10,12,15,17-octaene-16-carboxylate (PubChem CID 102401747) has the molecular formula C21H18BrNO2 and a molecular weight of 396.28 g/mol. Its IUPAC name is ethyl 18-bromo-3-methyl-2-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),3,5,8,10,12,15,17-octaene-16-carboxylate.
| Compound Name | ethyl 18-bromo-3-methyl-2-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),3,5,8,10,12,15,17-octaene-16-carboxylate |
|---|---|
| PubChem CID | 102401747 |
| Molecular Formula | C21H18BrNO2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | ethyl 18-bromo-3-methyl-2-azatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),3,5,8,10,12,15,17-octaene-16-carboxylate |
| SMILES | CCOC(=O)c1cc(Br)c2c(c1)-c1ccccc1Cc1ccc(C)n1-2 |
| InChI | InChI=1S/C21H18BrNO2/c1-3-25-21(24)15-11-18-17-7-5-4-6-14(17)10-16-9-8-13(2)23(16)20(18)19(22)12-15/h4-9,11-12H,3,10H2,1-2H3 |
| InChIKey | YLEHCTVIOHJDBT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|