C34H59N3O9 — CID 102402289
(5S,8S,11S,14R,17R)-7-methyl-2,8,17-tris(2-methylpropyl)-5,11,14-tri(propan-2-yl)-1,4,10-trioxa-7,13,16-triazacyclooctadecane-3,6,9,12,15,18-hexone (PubChem CID 102402289) has the molecular formula C34H59N3O9 and a molecular weight of 653.86 g/mol. Its IUPAC name is (5S,8S,11S,14R,17R)-7-methyl-2,8,17-tris(2-methylpropyl)-5,11,14-tri(propan-2-yl)-1,4,10-trioxa-7,13,16-triazacyclooctadecane-3,6,9,12,15,18-hexone.
| Compound Name | (5S,8S,11S,14R,17R)-7-methyl-2,8,17-tris(2-methylpropyl)-5,11,14-tri(propan-2-yl)-1,4,10-trioxa-7,13,16-triazacyclooctadecane-3,6,9,12,15,18-hexone |
|---|---|
| PubChem CID | 102402289 |
| Molecular Formula | C34H59N3O9 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.43 |
| IUPAC Name | (5S,8S,11S,14R,17R)-7-methyl-2,8,17-tris(2-methylpropyl)-5,11,14-tri(propan-2-yl)-1,4,10-trioxa-7,13,16-triazacyclooctadecane-3,6,9,12,15,18-hexone |
| SMILES | CC(C)CC1OC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C(C)C)OC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)OC1=O |
| InChI | InChI=1S/C34H59N3O9/c1-17(2)14-23-32(41)44-25(16-19(5)6)34(43)46-28(22(11)12)31(40)37(13)24(15-18(3)4)33(42)45-27(21(9)10)30(39)36-26(20(7)8)29(38)35-23/h17-28H,14-16H2,1-13H3,(H,35,38)(H,36,39)/t23-,24+,25?,26-,27+,28+/m1/s1 |
| InChIKey | WDNGHMADKZYJCM-NGBWTVKRSA-N |
| XLogP | 3.64 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|