C5H5N — CID 102402637
(1R,4S)-2-azabicyclo[2.2.0]hexa-2,5-diene (PubChem CID 102402637) has the molecular formula C5H5N and a molecular weight of 79.10 g/mol. Its IUPAC name is (1R,4S)-2-azabicyclo[2.2.0]hexa-2,5-diene.
| Compound Name | (1R,4S)-2-azabicyclo[2.2.0]hexa-2,5-diene |
|---|---|
| PubChem CID | 102402637 |
| Molecular Formula | C5H5N |
| Molecular Weight | 79.10 g/mol |
| Exact Mass | 79.04 |
| IUPAC Name | (1R,4S)-2-azabicyclo[2.2.0]hexa-2,5-diene |
| SMILES | C1=C[C@H]2N=C[C@@H]12 |
| InChI | InChI=1S/C5H5N/c1-2-5-4(1)3-6-5/h1-5H/t4-,5-/m1/s1 |
| InChIKey | UKZSOLAUQNXPLD-RFZPGFLSSA-N |
| XLogP | 0.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 79.10 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|