About 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete
2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete (PubChem CID 163565358) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete.
Molecular Properties
| Compound Name | 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete |
| PubChem CID | 163565358 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete |
| SMILES | C/C=C\C1C=NC1C |
| InChI | InChI=1S/C7H11N/c1-3-4-7-5-8-6(7)2/h3-7H,1-2H3/b4-3- |
| InChIKey | FUSNILZECRVWDJ-ARJAWSKDSA-N |
| XLogP | 1.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete?
The IUPAC name of 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete (CID 163565358) is 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete.
What is the SMILES notation for 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete?
The canonical SMILES for 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete is C/C=C\C1C=NC1C.
What is the InChIKey of 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete?
The InChIKey is FUSNILZECRVWDJ-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H11N/c1-3-4-7-5-8-6(7)2/h3-7H,1-2H3/b4-3-.
What are the key properties of 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete?
2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete has a molecular weight of 109.17 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(Z)-prop-1-enyl]-2,3-dihydroazete is sourced from PubChem (CID 163565358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).