About triethyl [(1S)-1-phenylethyl] silicate
triethyl [(1S)-1-phenylethyl] silicate (PubChem CID 102403172) has the molecular formula C14H24O4Si
and a molecular weight of 284.43 g/mol. Its IUPAC name is triethyl [(1S)-1-phenylethyl] silicate.
Molecular Properties
| Compound Name | triethyl [(1S)-1-phenylethyl] silicate |
| PubChem CID | 102403172 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | triethyl [(1S)-1-phenylethyl] silicate |
| SMILES | CCO[Si](OCC)(OCC)O[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C14H24O4Si/c1-5-15-19(16-6-2,17-7-3)18-13(4)14-11-9-8-10-12-14/h8-13H,5-7H2,1-4H3/t13-/m0/s1 |
| InChIKey | WYUOOWKMPZFRKO-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl [(1S)-1-phenylethyl] silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl [(1S)-1-phenylethyl] silicate?
The IUPAC name of triethyl [(1S)-1-phenylethyl] silicate (CID 102403172) is triethyl [(1S)-1-phenylethyl] silicate.
What is the SMILES notation for triethyl [(1S)-1-phenylethyl] silicate?
The canonical SMILES for triethyl [(1S)-1-phenylethyl] silicate is CCO[Si](OCC)(OCC)O[C@@H](C)c1ccccc1.
What is the InChIKey of triethyl [(1S)-1-phenylethyl] silicate?
The InChIKey is WYUOOWKMPZFRKO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H24O4Si/c1-5-15-19(16-6-2,17-7-3)18-13(4)14-11-9-8-10-12-14/h8-13H,5-7H2,1-4H3/t13-/m0/s1.
What are the key properties of triethyl [(1S)-1-phenylethyl] silicate?
triethyl [(1S)-1-phenylethyl] silicate has a molecular weight of 284.43 g/mol, XLogP of 3.31, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl [(1S)-1-phenylethyl] silicate is sourced from PubChem (CID 102403172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).