About 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one
6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one (PubChem CID 102405292) has the molecular formula C34H25N3O
and a molecular weight of 491.59 g/mol. Its IUPAC name is 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one |
| PubChem CID | 102405292 |
| Molecular Formula | C34H25N3O |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one |
| SMILES | Cc1nc(-c2ccccc2)n(-c2ccccc2)c(=O)c1/C=C/c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C34H25N3O/c1-24-29(34(38)37(28-17-9-4-10-18-28)33(35-24)26-15-7-3-8-16-26)22-21-27-23-32(25-13-5-2-6-14-25)36-31-20-12-11-19-30(27)31/h2-23H,1H3/b22-21+ |
| InChIKey | FPHTVRWNEUEGGK-QURGRASLSA-N |
| XLogP | 7.59 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one?
The IUPAC name of 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one (CID 102405292) is 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one.
What is the SMILES notation for 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one?
The canonical SMILES for 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one is Cc1nc(-c2ccccc2)n(-c2ccccc2)c(=O)c1/C=C/c1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one?
The InChIKey is FPHTVRWNEUEGGK-QURGRASLSA-N. The full InChI is InChI=1S/C34H25N3O/c1-24-29(34(38)37(28-17-9-4-10-18-28)33(35-24)26-15-7-3-8-16-26)22-21-27-23-32(25-13-5-2-6-14-25)36-31-20-12-11-19-30(27)31/h2-23H,1H3/b22-21+.
What are the key properties of 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one?
6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one has a molecular weight of 491.59 g/mol, XLogP of 7.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,3-diphenyl-5-[(E)-2-(2-phenylquinolin-4-yl)ethenyl]pyrimidin-4-one is sourced from PubChem (CID 102405292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).