C17H36O8P2 — CID 102406501
3,3-bis(diethoxyphosphoryl)-3-hexoxypropanal (PubChem CID 102406501) has the molecular formula C17H36O8P2 and a molecular weight of 430.42 g/mol. Its IUPAC name is 3,3-bis(diethoxyphosphoryl)-3-hexoxypropanal.
| Compound Name | 3,3-bis(diethoxyphosphoryl)-3-hexoxypropanal |
|---|---|
| PubChem CID | 102406501 |
| Molecular Formula | C17H36O8P2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3,3-bis(diethoxyphosphoryl)-3-hexoxypropanal |
| SMILES | CCCCCCOC(CC=O)(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H36O8P2/c1-6-11-12-13-16-21-17(14-15-18,26(19,22-7-2)23-8-3)27(20,24-9-4)25-10-5/h15H,6-14,16H2,1-5H3 |
| InChIKey | TVXHIQNUYBEUPM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|