C17H26O2Si — CID 102407695
ethyl 1-trimethylsilyl-4,5,8,9-tetrahydro-3H-benzo[7]annulene-6-carboxylate (PubChem CID 102407695) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is ethyl 1-trimethylsilyl-4,5,8,9-tetrahydro-3H-benzo[7]annulene-6-carboxylate.
| Compound Name | ethyl 1-trimethylsilyl-4,5,8,9-tetrahydro-3H-benzo[7]annulene-6-carboxylate |
|---|---|
| PubChem CID | 102407695 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | ethyl 1-trimethylsilyl-4,5,8,9-tetrahydro-3H-benzo[7]annulene-6-carboxylate |
| SMILES | CCOC(=O)C1=CCCC2=C(CCC=C2[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H26O2Si/c1-5-19-17(18)14-9-6-10-15-13(12-14)8-7-11-16(15)20(2,3)4/h9,11H,5-8,10,12H2,1-4H3 |
| InChIKey | KKJIYERMMFQPJI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|