C16H29O3P — CID 102407853
(1S,3R,5R,7S)-8-hexyl-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane (PubChem CID 102407853) has the molecular formula C16H29O3P and a molecular weight of 300.38 g/mol. Its IUPAC name is (1S,3R,5R,7S)-8-hexyl-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane.
| Compound Name | (1S,3R,5R,7S)-8-hexyl-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 102407853 |
| Molecular Formula | C16H29O3P |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (1S,3R,5R,7S)-8-hexyl-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
| SMILES | CCCCCCP1[C@@]2(C)C[C@]3(C)O[C@@](C)(C[C@@]1(C)O3)O2 |
| InChI | InChI=1S/C16H29O3P/c1-6-7-8-9-10-20-15(4)11-13(2)17-14(3,19-15)12-16(20,5)18-13/h6-12H2,1-5H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | RAFALZKWHQJCAT-WCVJEAGWSA-N |
| XLogP | 4.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|