C29H34O4S2 — CID 102408087
(2R,3R,4R)-6,6-bis(methylsulfanyl)-1,3,4-tris(phenylmethoxy)hex-5-en-2-ol (PubChem CID 102408087) has the molecular formula C29H34O4S2 and a molecular weight of 510.72 g/mol. Its IUPAC name is (2R,3R,4R)-6,6-bis(methylsulfanyl)-1,3,4-tris(phenylmethoxy)hex-5-en-2-ol.
| Compound Name | (2R,3R,4R)-6,6-bis(methylsulfanyl)-1,3,4-tris(phenylmethoxy)hex-5-en-2-ol |
|---|---|
| PubChem CID | 102408087 |
| Molecular Formula | C29H34O4S2 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (2R,3R,4R)-6,6-bis(methylsulfanyl)-1,3,4-tris(phenylmethoxy)hex-5-en-2-ol |
| SMILES | CSC(=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1)SC |
| InChI | InChI=1S/C29H34O4S2/c1-34-28(35-2)18-27(32-20-24-14-8-4-9-15-24)29(33-21-25-16-10-5-11-17-25)26(30)22-31-19-23-12-6-3-7-13-23/h3-18,26-27,29-30H,19-22H2,1-2H3/t26-,27-,29-/m1/s1 |
| InChIKey | YETLSZYKFZEWCQ-LSMIHOHGSA-N |
| XLogP | 6.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |