C18H33N2NaO4 — CID 102408292
sodium N-[(5S)-5-carboxy-5-(hexanoylamino)pentyl]hexanimidate (PubChem CID 102408292) has the molecular formula C18H33N2NaO4 and a molecular weight of 364.46 g/mol. Its IUPAC name is sodium N-[(5S)-5-carboxy-5-(hexanoylamino)pentyl]hexanimidate.
| Compound Name | sodium N-[(5S)-5-carboxy-5-(hexanoylamino)pentyl]hexanimidate |
|---|---|
| PubChem CID | 102408292 |
| Molecular Formula | C18H33N2NaO4 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | sodium N-[(5S)-5-carboxy-5-(hexanoylamino)pentyl]hexanimidate |
| SMILES | CCCCCC(=O)N[C@@H](CCCC/N=C(\[O-])CCCCC)C(=O)O.[Na+] |
| InChI | InChI=1S/C18H34N2O4.Na/c1-3-5-7-12-16(21)19-14-10-9-11-15(18(23)24)20-17(22)13-8-6-4-2;/h15H,3-14H2,1-2H3,(H,19,21)(H,20,22)(H,23,24);/q;+1/p-1/t15-;/m0./s1 |
| InChIKey | AFQJXACOWIKSBX-RSAXXLAASA-M |
| XLogP | -0.35 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|