C13H10F3NO3 — CID 102408872
5-[4-(trifluoromethyl)phenyl]-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylic acid (PubChem CID 102408872) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylic acid.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 102408872 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylic acid |
| SMILES | O=C(O)C1OC(c2ccc(C(F)(F)F)cc2)=NC12CC2 |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)8-3-1-7(2-4-8)10-17-12(5-6-12)9(20-10)11(18)19/h1-4,9H,5-6H2,(H,18,19) |
| InChIKey | OLOFEWFUJWFLAK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |