C15H16FNO3 — CID 10802476
methyl 2-ethyl-5-(3-fluorophenyl)-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylate (PubChem CID 10802476) has the molecular formula C15H16FNO3 and a molecular weight of 277.29 g/mol. Its IUPAC name is methyl 2-ethyl-5-(3-fluorophenyl)-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylate.
| Compound Name | methyl 2-ethyl-5-(3-fluorophenyl)-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylate |
|---|---|
| PubChem CID | 10802476 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | methyl 2-ethyl-5-(3-fluorophenyl)-6-oxa-4-azaspiro[2.4]hept-4-ene-7-carboxylate |
| SMILES | CCC1CC12N=C(c1cccc(F)c1)OC2C(=O)OC |
| InChI | InChI=1S/C15H16FNO3/c1-3-10-8-15(10)12(14(18)19-2)20-13(17-15)9-5-4-6-11(16)7-9/h4-7,10,12H,3,8H2,1-2H3 |
| InChIKey | UWAREHUQJTYQRF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |