C14H24N3O11P — CID 102410730
[(2S,3S,4S)-2-amino-3,4,5-trihydroxypentyl]-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid (PubChem CID 102410730) has the molecular formula C14H24N3O11P and a molecular weight of 441.33 g/mol. Its IUPAC name is [(2S,3S,4S)-2-amino-3,4,5-trihydroxypentyl]-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid.
| Compound Name | [(2S,3S,4S)-2-amino-3,4,5-trihydroxypentyl]-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 102410730 |
| Molecular Formula | C14H24N3O11P |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [(2S,3S,4S)-2-amino-3,4,5-trihydroxypentyl]-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]phosphinic acid |
| SMILES | N[C@H](CP(=O)(O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C14H24N3O11P/c15-6(10(21)7(19)3-18)5-29(25,26)27-4-8-11(22)12(23)13(28-8)17-2-1-9(20)16-14(17)24/h1-2,6-8,10-13,18-19,21-23H,3-5,15H2,(H,25,26)(H,16,20,24)/t6-,7+,8-,10+,11-,12-,13-/m1/s1 |
| InChIKey | RTNPODULOGCQSO-PHOZYCPSSA-N |
| XLogP | -4.60 |
| TPSA | 237.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|