C13H16O5 — CID 102412057
[(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] prop-2-enoate (PubChem CID 102412057) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] prop-2-enoate.
| Compound Name | [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 102412057 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(2R,3S,4R,5S)-4-acetyloxy-2,5-bis(ethenyl)oxolan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C=C)O[C@@H]1C=C |
| InChI | InChI=1S/C13H16O5/c1-5-9-12(16-8(4)14)13(10(6-2)17-9)18-11(15)7-3/h5-7,9-10,12-13H,1-3H2,4H3/t9-,10+,12+,13-/m0/s1 |
| InChIKey | FYSMQHUECWGIIO-YGNMPJRFSA-N |
| XLogP | 1.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|