C21H26O6 — CID 102412736
diethyl 4,5,5-trimethyl-3-oxo-7,9-dihydro-1H-cyclopenta[h]isochromene-8,8-dicarboxylate (PubChem CID 102412736) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is diethyl 4,5,5-trimethyl-3-oxo-7,9-dihydro-1H-cyclopenta[h]isochromene-8,8-dicarboxylate.
| Compound Name | diethyl 4,5,5-trimethyl-3-oxo-7,9-dihydro-1H-cyclopenta[h]isochromene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 102412736 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | diethyl 4,5,5-trimethyl-3-oxo-7,9-dihydro-1H-cyclopenta[h]isochromene-8,8-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=CC(C)(C)C3=C(C)C(=O)OCC3=C2C1 |
| InChI | InChI=1S/C21H26O6/c1-6-25-18(23)21(19(24)26-7-2)9-13-8-20(4,5)16-12(3)17(22)27-11-15(16)14(13)10-21/h8H,6-7,9-11H2,1-5H3 |
| InChIKey | SOCNCCYPAVHEBM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|