C11H16O2 — CID 10241404
(3aS,3bR,6aS,7aS)-3b-hydroxy-2,3,3a,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-4-one (PubChem CID 10241404) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3aS,3bR,6aS,7aS)-3b-hydroxy-2,3,3a,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-4-one.
| Compound Name | (3aS,3bR,6aS,7aS)-3b-hydroxy-2,3,3a,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-4-one |
|---|---|
| PubChem CID | 10241404 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3aS,3bR,6aS,7aS)-3b-hydroxy-2,3,3a,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-4-one |
| SMILES | O=C1CC[C@H]2C[C@@H]3CCC[C@@H]3[C@@]12O |
| InChI | InChI=1S/C11H16O2/c12-10-5-4-8-6-7-2-1-3-9(7)11(8,10)13/h7-9,13H,1-6H2/t7-,8-,9-,11+/m0/s1 |
| InChIKey | OFTSTXNUTWWRNF-FTYOSLGDSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |