C12H18O2 — CID 121003783
(3aS,4aS,8bS)-8b-hydroxy-2,3,3a,4,4a,5,6,7,8,8a-decahydrocyclopenta[a]inden-1-one (PubChem CID 121003783) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3aS,4aS,8bS)-8b-hydroxy-2,3,3a,4,4a,5,6,7,8,8a-decahydrocyclopenta[a]inden-1-one.
| Compound Name | (3aS,4aS,8bS)-8b-hydroxy-2,3,3a,4,4a,5,6,7,8,8a-decahydrocyclopenta[a]inden-1-one |
|---|---|
| PubChem CID | 121003783 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3aS,4aS,8bS)-8b-hydroxy-2,3,3a,4,4a,5,6,7,8,8a-decahydrocyclopenta[a]inden-1-one |
| SMILES | O=C1CC[C@H]2C[C@@H]3CCCCC3[C@]12O |
| InChI | InChI=1S/C12H18O2/c13-11-6-5-9-7-8-3-1-2-4-10(8)12(9,11)14/h8-10,14H,1-7H2/t8-,9-,10?,12-/m0/s1 |
| InChIKey | MINNYGKPULGAJY-JHPJKXODSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |