C16H13I2NO2S — CID 102414401
3,6-diiodo-1-(4-methylphenyl)sulfonyl-2H-quinoline (PubChem CID 102414401) has the molecular formula C16H13I2NO2S and a molecular weight of 537.16 g/mol. Its IUPAC name is 3,6-diiodo-1-(4-methylphenyl)sulfonyl-2H-quinoline.
| Compound Name | 3,6-diiodo-1-(4-methylphenyl)sulfonyl-2H-quinoline |
|---|---|
| PubChem CID | 102414401 |
| Molecular Formula | C16H13I2NO2S |
| Molecular Weight | 537.16 g/mol |
| Exact Mass | 536.88 |
| IUPAC Name | 3,6-diiodo-1-(4-methylphenyl)sulfonyl-2H-quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(I)=Cc3cc(I)ccc32)cc1 |
| InChI | InChI=1S/C16H13I2NO2S/c1-11-2-5-15(6-3-11)22(20,21)19-10-14(18)9-12-8-13(17)4-7-16(12)19/h2-9H,10H2,1H3 |
| InChIKey | GVTJAAXOHLHVNZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.16 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|