C13H17NO4 — CID 102415314
(4aR,7S,8R,8aR)-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-[1,3]dioxino[5,4-b]pyridine-7,8-diol (PubChem CID 102415314) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (4aR,7S,8R,8aR)-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-[1,3]dioxino[5,4-b]pyridine-7,8-diol.
| Compound Name | (4aR,7S,8R,8aR)-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-[1,3]dioxino[5,4-b]pyridine-7,8-diol |
|---|---|
| PubChem CID | 102415314 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (4aR,7S,8R,8aR)-2-phenyl-4a,5,6,7,8,8a-hexahydro-4H-[1,3]dioxino[5,4-b]pyridine-7,8-diol |
| SMILES | O[C@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2NC[C@@H]1O |
| InChI | InChI=1S/C13H17NO4/c15-10-6-14-9-7-17-13(18-12(9)11(10)16)8-4-2-1-3-5-8/h1-5,9-16H,6-7H2/t9-,10+,11-,12-,13?/m1/s1 |
| InChIKey | HPHNQCIDSJUXPV-CEHFSTBQSA-N |
| XLogP | -0.21 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |