C20H25ClOS — CID 102415372
2-(2-chloro-4-methoxy-4-phenylbutyl)sulfanyl-1,3,5-trimethylbenzene (PubChem CID 102415372) has the molecular formula C20H25ClOS and a molecular weight of 348.94 g/mol. Its IUPAC name is 2-(2-chloro-4-methoxy-4-phenylbutyl)sulfanyl-1,3,5-trimethylbenzene.
| Compound Name | 2-(2-chloro-4-methoxy-4-phenylbutyl)sulfanyl-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 102415372 |
| Molecular Formula | C20H25ClOS |
| Molecular Weight | 348.94 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-(2-chloro-4-methoxy-4-phenylbutyl)sulfanyl-1,3,5-trimethylbenzene |
| SMILES | COC(CC(Cl)CSc1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C20H25ClOS/c1-14-10-15(2)20(16(3)11-14)23-13-18(21)12-19(22-4)17-8-6-5-7-9-17/h5-11,18-19H,12-13H2,1-4H3 |
| InChIKey | MUPHLBWRJOKPEP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.94 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|