C15H24O4 — CID 124630788
[(1R,3S)-1,3,5,5-tetramethoxypentyl]benzene (PubChem CID 124630788) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [(1R,3S)-1,3,5,5-tetramethoxypentyl]benzene.
| Compound Name | [(1R,3S)-1,3,5,5-tetramethoxypentyl]benzene |
|---|---|
| PubChem CID | 124630788 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(1R,3S)-1,3,5,5-tetramethoxypentyl]benzene |
| SMILES | COC(C[C@H](C[C@@H](OC)c1ccccc1)OC)OC |
| InChI | InChI=1S/C15H24O4/c1-16-13(11-15(18-3)19-4)10-14(17-2)12-8-6-5-7-9-12/h5-9,13-15H,10-11H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | NBJJECDPNZLNAN-UONOGXRCSA-N |
| XLogP | 2.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|