C51H48N6 — CID 102416897
4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 102416897) has the molecular formula C51H48N6 and a molecular weight of 744.99 g/mol. Its IUPAC name is 4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102416897 |
| Molecular Formula | C51H48N6 |
| Molecular Weight | 744.99 g/mol |
| Exact Mass | 744.39 |
| IUPAC Name | 4-[(E)-2-[4-[4,6-bis[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(-c3nc(-c4ccc(/C=C/c5ccc(N(C)C)cc5)cc4)nc(-c4ccc(/C=C/c5ccc(N(C)C)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H48N6/c1-55(2)46-31-19-40(20-32-46)10-7-37-13-25-43(26-14-37)49-52-50(44-27-15-38(16-28-44)8-11-41-21-33-47(34-22-41)56(3)4)54-51(53-49)45-29-17-39(18-30-45)9-12-42-23-35-48(36-24-42)57(5)6/h7-36H,1-6H3/b10-7+,11-8+,12-9+ |
| InChIKey | LSTYNMUAXJMNTL-SRDSWEMOSA-N |
| XLogP | 11.58 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.99 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|