C109H69N — CID 102418435
2-[3-[3,4-bis[4-[3,4-bis(4-ethynylphenyl)-2,5-diphenylphenyl]phenyl]-2,5-diphenylphenyl]phenyl]pyridine (PubChem CID 102418435) has the molecular formula C109H69N and a molecular weight of 1392.76 g/mol. Its IUPAC name is 2-[3-[3,4-bis[4-[3,4-bis(4-ethynylphenyl)-2,5-diphenylphenyl]phenyl]-2,5-diphenylphenyl]phenyl]pyridine.
| Compound Name | 2-[3-[3,4-bis[4-[3,4-bis(4-ethynylphenyl)-2,5-diphenylphenyl]phenyl]-2,5-diphenylphenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 102418435 |
| Molecular Formula | C109H69N |
| Molecular Weight | 1392.76 g/mol |
| Exact Mass | 1391.54 |
| IUPAC Name | 2-[3-[3,4-bis[4-[3,4-bis(4-ethynylphenyl)-2,5-diphenylphenyl]phenyl]-2,5-diphenylphenyl]phenyl]pyridine |
| SMILES | C#Cc1ccc(-c2c(-c3ccccc3)cc(-c3ccc(-c4c(-c5ccccc5)cc(-c5cccc(-c6ccccn6)c5)c(-c5ccccc5)c4-c4ccc(-c5cc(-c6ccccc6)c(-c6ccc(C#C)cc6)c(-c6ccc(C#C)cc6)c5-c5ccccc5)cc4)cc3)c(-c3ccccc3)c2-c2ccc(C#C)cc2)cc1 |
| InChI | InChI=1S/C109H69N/c1-5-74-45-53-86(54-46-74)104-94(78-30-15-9-16-31-78)71-97(101(83-36-21-12-22-37-83)107(104)89-57-49-76(7-3)50-58-89)81-61-65-88(66-62-81)106-96(80-34-19-11-20-35-80)73-99(92-42-29-43-93(70-92)100-44-27-28-69-110-100)103(85-40-25-14-26-41-85)109(106)91-67-63-82(64-68-91)98-72-95(79-32-17-10-18-33-79)105(87-55-47-75(6-2)48-56-87)108(90-59-51-77(8-4)52-60-90)102(98)84-38-23-13-24-39-84/h1-4,9-73H |
| InChIKey | DBMZIYWIAHSDKM-UHFFFAOYSA-N |
| XLogP | 27.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 110 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1392.76 |
| LogP ≤ 5 | 27.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|