C11H20O3 — CID 10241901
2-methoxy-3-[(E)-1-methoxybut-2-enyl]oxane (PubChem CID 10241901) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-methoxy-3-[(E)-1-methoxybut-2-enyl]oxane.
| Compound Name | 2-methoxy-3-[(E)-1-methoxybut-2-enyl]oxane |
|---|---|
| PubChem CID | 10241901 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-methoxy-3-[(E)-1-methoxybut-2-enyl]oxane |
| SMILES | C/C=C/C(OC)C1CCCOC1OC |
| InChI | InChI=1S/C11H20O3/c1-4-6-10(12-2)9-7-5-8-14-11(9)13-3/h4,6,9-11H,5,7-8H2,1-3H3/b6-4+ |
| InChIKey | VZQQFQHRHSDDNZ-GQCTYLIASA-N |
| XLogP | 1.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|