C13H26O4 — CID 23635077
(3S,4R,5S,6S)-3,5-dimethoxy-7-(methoxymethoxy)-4,6-dimethylhept-1-ene (PubChem CID 23635077) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3S,4R,5S,6S)-3,5-dimethoxy-7-(methoxymethoxy)-4,6-dimethylhept-1-ene.
| Compound Name | (3S,4R,5S,6S)-3,5-dimethoxy-7-(methoxymethoxy)-4,6-dimethylhept-1-ene |
|---|---|
| PubChem CID | 23635077 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3S,4R,5S,6S)-3,5-dimethoxy-7-(methoxymethoxy)-4,6-dimethylhept-1-ene |
| SMILES | C=C[C@H](OC)[C@@H](C)[C@@H](OC)[C@@H](C)COCOC |
| InChI | InChI=1S/C13H26O4/c1-7-12(15-5)11(3)13(16-6)10(2)8-17-9-14-4/h7,10-13H,1,8-9H2,2-6H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | CECSAPYGODHDPA-RNJOBUHISA-N |
| XLogP | 2.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|