C11H20O2 — CID 123802921
(3R,4S,6S)-2-ethenyl-6-methoxy-3,4,5-trimethyloxane (PubChem CID 123802921) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (3R,4S,6S)-2-ethenyl-6-methoxy-3,4,5-trimethyloxane.
| Compound Name | (3R,4S,6S)-2-ethenyl-6-methoxy-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 123802921 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3R,4S,6S)-2-ethenyl-6-methoxy-3,4,5-trimethyloxane |
| SMILES | C=CC1O[C@H](OC)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C11H20O2/c1-6-10-8(3)7(2)9(4)11(12-5)13-10/h6-11H,1H2,2-5H3/t7-,8+,9?,10?,11-/m0/s1 |
| InChIKey | LGZHYTDATZWFKK-SHGARLFGSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|