C14H28O4 — CID 10848940
(2R,3R,4R,7S)-7-methoxy-3-(methoxymethoxy)-2,4-dimethylnon-8-en-1-ol (PubChem CID 10848940) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is (2R,3R,4R,7S)-7-methoxy-3-(methoxymethoxy)-2,4-dimethylnon-8-en-1-ol.
| Compound Name | (2R,3R,4R,7S)-7-methoxy-3-(methoxymethoxy)-2,4-dimethylnon-8-en-1-ol |
|---|---|
| PubChem CID | 10848940 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (2R,3R,4R,7S)-7-methoxy-3-(methoxymethoxy)-2,4-dimethylnon-8-en-1-ol |
| SMILES | C=C[C@H](CC[C@@H](C)[C@@H](OCOC)[C@H](C)CO)OC |
| InChI | InChI=1S/C14H28O4/c1-6-13(17-5)8-7-11(2)14(12(3)9-15)18-10-16-4/h6,11-15H,1,7-10H2,2-5H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | UEXMPMAWQMBASM-AAVRWANBSA-N |
| XLogP | 2.22 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|