C18H32O5 — CID 134937398
(4R,6R)-6-[(4S,5S,6R)-6-ethenyl-5-methyl-1,3-dioxan-4-yl]-8-(methoxymethoxy)-4-methyloct-1-en-3-ol (PubChem CID 134937398) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (4R,6R)-6-[(4S,5S,6R)-6-ethenyl-5-methyl-1,3-dioxan-4-yl]-8-(methoxymethoxy)-4-methyloct-1-en-3-ol.
| Compound Name | (4R,6R)-6-[(4S,5S,6R)-6-ethenyl-5-methyl-1,3-dioxan-4-yl]-8-(methoxymethoxy)-4-methyloct-1-en-3-ol |
|---|---|
| PubChem CID | 134937398 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (4R,6R)-6-[(4S,5S,6R)-6-ethenyl-5-methyl-1,3-dioxan-4-yl]-8-(methoxymethoxy)-4-methyloct-1-en-3-ol |
| SMILES | C=CC(O)[C@H](C)C[C@H](CCOCOC)[C@@H]1OCO[C@H](C=C)[C@@H]1C |
| InChI | InChI=1S/C18H32O5/c1-6-16(19)13(3)10-15(8-9-21-11-20-5)18-14(4)17(7-2)22-12-23-18/h6-7,13-19H,1-2,8-12H2,3-5H3/t13-,14+,15+,16?,17-,18-/m1/s1 |
| InChIKey | NNNJSJLIPBDHAY-XYMCUYTPSA-N |
| XLogP | 2.75 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|