C16H27LiO4 — CID 10637236
lithium (2S)-2-[(2S,3S,5R)-6-methoxy-6-(3-methoxypropa-1,2-dienyl)-3,5-dimethyloxan-2-yl]butan-1-ol (PubChem CID 10637236) has the molecular formula C16H27LiO4 and a molecular weight of 290.33 g/mol. Its IUPAC name is lithium (2S)-2-[(2S,3S,5R)-6-methoxy-6-(3-methoxypropa-1,2-dienyl)-3,5-dimethyloxan-2-yl]butan-1-ol.
| Compound Name | lithium (2S)-2-[(2S,3S,5R)-6-methoxy-6-(3-methoxypropa-1,2-dienyl)-3,5-dimethyloxan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 10637236 |
| Molecular Formula | C16H27LiO4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | lithium (2S)-2-[(2S,3S,5R)-6-methoxy-6-(3-methoxypropa-1,2-dienyl)-3,5-dimethyloxan-2-yl]butan-1-ol |
| SMILES | CC[C@@H](CO)[C@H]1OC(C=C=[C-]OC)(OC)[C@H](C)C[C@@H]1C.[Li+] |
| InChI | InChI=1S/C16H27O4.Li/c1-6-14(11-17)15-12(2)10-13(3)16(19-5,20-15)8-7-9-18-4;/h8,12-15,17H,6,10-11H2,1-5H3;/q-1;+1/t12-,13+,14-,15-,16?;/m0./s1 |
| InChIKey | CCNHIPXONFPOFJ-HJVDHVSNSA-N |
| XLogP | -0.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|