C19H38O3 — CID 142528966
10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-ol (PubChem CID 142528966) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-ol.
| Compound Name | 10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-ol |
|---|---|
| PubChem CID | 142528966 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 10,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-ol |
| SMILES | C=CC(C)CC(C)C(O)CCC(C)C(CCCC)(OC)OC |
| InChI | InChI=1S/C19H38O3/c1-8-10-13-19(21-6,22-7)17(5)11-12-18(20)16(4)14-15(3)9-2/h9,15-18,20H,2,8,10-14H2,1,3-7H3 |
| InChIKey | XHWBXJXKNDAFPM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|