C14H26O5 — CID 23635076
[(2S,3S,4R,5S)-5-methoxy-1-(methoxymethoxy)-2,4-dimethylhept-6-en-3-yl] acetate (PubChem CID 23635076) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-5-methoxy-1-(methoxymethoxy)-2,4-dimethylhept-6-en-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5S)-5-methoxy-1-(methoxymethoxy)-2,4-dimethylhept-6-en-3-yl] acetate |
|---|---|
| PubChem CID | 23635076 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [(2S,3S,4R,5S)-5-methoxy-1-(methoxymethoxy)-2,4-dimethylhept-6-en-3-yl] acetate |
| SMILES | C=C[C@H](OC)[C@@H](C)[C@@H](OC(C)=O)[C@@H](C)COCOC |
| InChI | InChI=1S/C14H26O5/c1-7-13(17-6)11(3)14(19-12(4)15)10(2)8-18-9-16-5/h7,10-11,13-14H,1,8-9H2,2-6H3/t10-,11+,13-,14-/m0/s1 |
| InChIKey | CHDNDYUXALIPLH-XCCSTKFXSA-N |
| XLogP | 2.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|