C20H32O8 — CID 159458927
[(2S,3R,4S,6S)-6-acetyloxy-2,3-dimethyloxan-4-yl] acetate;[(2S,3R,4S)-2,3-dimethyl-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 159458927) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(2S,3R,4S,6S)-6-acetyloxy-2,3-dimethyloxan-4-yl] acetate;[(2S,3R,4S)-2,3-dimethyl-3,4-dihydro-2H-pyran-4-yl] acetate.
| Compound Name | [(2S,3R,4S,6S)-6-acetyloxy-2,3-dimethyloxan-4-yl] acetate;[(2S,3R,4S)-2,3-dimethyl-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|---|
| PubChem CID | 159458927 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(2S,3R,4S,6S)-6-acetyloxy-2,3-dimethyloxan-4-yl] acetate;[(2S,3R,4S)-2,3-dimethyl-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CO[C@@H](C)[C@H]1C.CC(=O)O[C@H]1C[C@H](OC(C)=O)[C@H](C)[C@H](C)O1 |
| InChI | InChI=1S/C11H18O5.C9H14O3/c1-6-7(2)14-11(16-9(4)13)5-10(6)15-8(3)12;1-6-7(2)11-5-4-9(6)12-8(3)10/h6-7,10-11H,5H2,1-4H3;4-7,9H,1-3H3/t6-,7+,10+,11+;6-,7+,9+/m11/s1 |
| InChIKey | LUILDMDREURLIJ-JLLISFOMSA-N |
| XLogP | 2.74 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|