C25H34O15 — CID 134974788
[(2R,3R,4S)-4,5-diacetyloxy-3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134974788) has the molecular formula C25H34O15 and a molecular weight of 574.53 g/mol. Its IUPAC name is [(2R,3R,4S)-4,5-diacetyloxy-3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-4,5-diacetyloxy-3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134974788 |
| Molecular Formula | C25H34O15 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | [(2R,3R,4S)-4,5-diacetyloxy-3-[(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-methyloxan-2-yl]oxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](OC(C)=O)C(OC(C)=O)=CO[C@@H]2COC(C)=O)[C@H](C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H34O15/c1-11-21(36-15(5)29)23(37-16(6)30)20(9-33-13(3)27)39-25(11)40-22-18(8-32-12(2)26)34-10-19(35-14(4)28)24(22)38-17(7)31/h10-11,18,20-25H,8-9H2,1-7H3/t11-,18-,20-,21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | RKKFMGQXQHHDER-HJRHSKQJSA-N |
| XLogP | 0.46 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|