C22H26N4O4 — CID 102421163
2-diazo-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-diethyl-N'-phenylpropanediamide (PubChem CID 102421163) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-diazo-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-diethyl-N'-phenylpropanediamide.
| Compound Name | 2-diazo-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-diethyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 102421163 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-diazo-N'-[(2,4-dimethoxyphenyl)methyl]-N,N-diethyl-N'-phenylpropanediamide |
| SMILES | CCN(CC)C(=O)C(=[N+]=[N-])C(=O)N(Cc1ccc(OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O4/c1-5-25(6-2)21(27)20(24-23)22(28)26(17-10-8-7-9-11-17)15-16-12-13-18(29-3)14-19(16)30-4/h7-14H,5-6,15H2,1-4H3 |
| InChIKey | PJNHZOYDIDCFBT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|