C15H24N4O2 — CID 102423062
2-(1,3-dimethyl-1,3-diazinan-2-ylidene)-N,N'-bis(prop-2-enyl)propanediamide (PubChem CID 102423062) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)-N,N'-bis(prop-2-enyl)propanediamide.
| Compound Name | 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)-N,N'-bis(prop-2-enyl)propanediamide |
|---|---|
| PubChem CID | 102423062 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)-N,N'-bis(prop-2-enyl)propanediamide |
| SMILES | C=CCNC(=O)C(C(=O)NCC=C)=C1N(C)CCCN1C |
| InChI | InChI=1S/C15H24N4O2/c1-5-8-16-13(20)12(14(21)17-9-6-2)15-18(3)10-7-11-19(15)4/h5-6H,1-2,7-11H2,3-4H3,(H,16,20)(H,17,21) |
| InChIKey | SKXZUJCTIWNBJA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|