C19H16O4 — CID 102423081
2-(2-benzyl-4,6-dihydroxyphenyl)-6-methylpyran-4-one (PubChem CID 102423081) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-(2-benzyl-4,6-dihydroxyphenyl)-6-methylpyran-4-one.
| Compound Name | 2-(2-benzyl-4,6-dihydroxyphenyl)-6-methylpyran-4-one |
|---|---|
| PubChem CID | 102423081 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-(2-benzyl-4,6-dihydroxyphenyl)-6-methylpyran-4-one |
| SMILES | Cc1cc(=O)cc(-c2c(O)cc(O)cc2Cc2ccccc2)o1 |
| InChI | InChI=1S/C19H16O4/c1-12-7-15(20)11-18(23-12)19-14(9-16(21)10-17(19)22)8-13-5-3-2-4-6-13/h2-7,9-11,21-22H,8H2,1H3 |
| InChIKey | HRXVSDFEGWNTIH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |