C41H43NO6 — CID 102423157
N-benzyl-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hydroxylamine (PubChem CID 102423157) has the molecular formula C41H43NO6 and a molecular weight of 645.80 g/mol. Its IUPAC name is N-benzyl-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hydroxylamine.
| Compound Name | N-benzyl-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 102423157 |
| Molecular Formula | C41H43NO6 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | N-benzyl-N-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]hydroxylamine |
| SMILES | ON(Cc1ccccc1)C1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H43NO6/c43-42(26-32-16-6-1-7-17-32)41-40(47-30-36-24-14-5-15-25-36)39(46-29-35-22-12-4-13-23-35)38(45-28-34-20-10-3-11-21-34)37(48-41)31-44-27-33-18-8-2-9-19-33/h1-25,37-41,43H,26-31H2/t37-,38-,39+,40-,41?/m1/s1 |
| InChIKey | IJMDZSUXBJEIGF-WWGFXPMHSA-N |
| XLogP | 7.58 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|