C11H16BNO2 — CID 102423733
(2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienenitrile (PubChem CID 102423733) has the molecular formula C11H16BNO2 and a molecular weight of 205.07 g/mol. Its IUPAC name is (2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienenitrile.
| Compound Name | (2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 102423733 |
| Molecular Formula | C11H16BNO2 |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2E,4Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienenitrile |
| SMILES | CC1(C)OB(/C=C\C=C\C#N)OC1(C)C |
| InChI | InChI=1S/C11H16BNO2/c1-10(2)11(3,4)15-12(14-10)8-6-5-7-9-13/h5-8H,1-4H3/b7-5+,8-6- |
| InChIKey | FMNKUKRVCDNBBZ-YMBWGVAGSA-N |
| XLogP | 2.25 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|