C14H25BO2Si — CID 11054535
trimethyl-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-1-ynyl]silane (PubChem CID 11054535) has the molecular formula C14H25BO2Si and a molecular weight of 264.25 g/mol. Its IUPAC name is trimethyl-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-1-ynyl]silane.
| Compound Name | trimethyl-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-1-ynyl]silane |
|---|---|
| PubChem CID | 11054535 |
| Molecular Formula | C14H25BO2Si |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | trimethyl-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-1-ynyl]silane |
| SMILES | CC1(C)OB(/C=C/CC#C[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C14H25BO2Si/c1-13(2)14(3,4)17-15(16-13)11-9-8-10-12-18(5,6)7/h9,11H,8H2,1-7H3/b11-9+ |
| InChIKey | CYUBHELBTAHLQE-PKNBQFBNSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|