C24H44O8Si — CID 102424487
triethyl-[(3E,5Z)-7-(methoxymethoxy)-3,4,5-tris(methoxymethoxymethyl)hepta-3,5-dien-1-ynyl]silane (PubChem CID 102424487) has the molecular formula C24H44O8Si and a molecular weight of 488.69 g/mol. Its IUPAC name is triethyl-[(3E,5Z)-7-(methoxymethoxy)-3,4,5-tris(methoxymethoxymethyl)hepta-3,5-dien-1-ynyl]silane.
| Compound Name | triethyl-[(3E,5Z)-7-(methoxymethoxy)-3,4,5-tris(methoxymethoxymethyl)hepta-3,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 102424487 |
| Molecular Formula | C24H44O8Si |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | triethyl-[(3E,5Z)-7-(methoxymethoxy)-3,4,5-tris(methoxymethoxymethyl)hepta-3,5-dien-1-ynyl]silane |
| SMILES | CC[Si](C#C/C(COCOC)=C(COCOC)/C(=C/COCOC)COCOC)(CC)CC |
| InChI | InChI=1S/C24H44O8Si/c1-8-33(9-2,10-3)14-12-23(16-31-20-27-6)24(17-32-21-28-7)22(15-30-19-26-5)11-13-29-18-25-4/h11H,8-10,13,15-21H2,1-7H3/b22-11+,24-23- |
| InChIKey | XQLWLHBAIJYAMJ-WYLFGXDRSA-N |
| XLogP | 3.74 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|