C24H44O4Si — CID 102424482
[(3E,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-triethylsilane (PubChem CID 102424482) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is [(3E,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-triethylsilane.
| Compound Name | [(3E,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-triethylsilane |
|---|---|
| PubChem CID | 102424482 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [(3E,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-triethylsilane |
| SMILES | CCOC/C=C(COCC)/C(COCC)=C(/C#C[Si](CC)(CC)CC)COCC |
| InChI | InChI=1S/C24H44O4Si/c1-8-25-17-15-22(19-26-9-2)24(21-28-11-4)23(20-27-10-3)16-18-29(12-5,13-6)14-7/h15H,8-14,17,19-21H2,1-7H3/b22-15+,24-23- |
| InChIKey | MCFKWRKIHVAANB-NMWHAAFCSA-N |
| XLogP | 5.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|