C23H38OSi2 — CID 102237629
triethyl-[2-[2-(methoxymethyl)-3-(2-triethylsilylethynyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane (PubChem CID 102237629) has the molecular formula C23H38OSi2 and a molecular weight of 386.73 g/mol. Its IUPAC name is triethyl-[2-[2-(methoxymethyl)-3-(2-triethylsilylethynyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane.
| Compound Name | triethyl-[2-[2-(methoxymethyl)-3-(2-triethylsilylethynyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 102237629 |
| Molecular Formula | C23H38OSi2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | triethyl-[2-[2-(methoxymethyl)-3-(2-triethylsilylethynyl)cyclopenta-1,3-dien-1-yl]ethynyl]silane |
| SMILES | CC[Si](C#CC1=CCC(C#C[Si](CC)(CC)CC)=C1COC)(CC)CC |
| InChI | InChI=1S/C23H38OSi2/c1-8-25(9-2,10-3)18-16-21-14-15-22(23(21)20-24-7)17-19-26(11-4,12-5)13-6/h14H,8-13,15,20H2,1-7H3 |
| InChIKey | WSUFBBLJAUGAAI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|