C13H22O2Si — CID 177459648
[(E)-5-methoxy-3-(3-methoxyprop-1-en-2-yl)pent-3-en-1-ynyl]-trimethylsilane (PubChem CID 177459648) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is [(E)-5-methoxy-3-(3-methoxyprop-1-en-2-yl)pent-3-en-1-ynyl]-trimethylsilane.
| Compound Name | [(E)-5-methoxy-3-(3-methoxyprop-1-en-2-yl)pent-3-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 177459648 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [(E)-5-methoxy-3-(3-methoxyprop-1-en-2-yl)pent-3-en-1-ynyl]-trimethylsilane |
| SMILES | C=C(COC)/C(C#C[Si](C)(C)C)=C\COC |
| InChI | InChI=1S/C13H22O2Si/c1-12(11-15-3)13(7-9-14-2)8-10-16(4,5)6/h7H,1,9,11H2,2-6H3/b13-7- |
| InChIKey | OUUKMONZJFKSTQ-QPEQYQDCSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|