C10H20O3 — CID 102425683
(2R)-4-(1-hydroxycyclohexyl)butane-1,2-diol (PubChem CID 102425683) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2R)-4-(1-hydroxycyclohexyl)butane-1,2-diol.
| Compound Name | (2R)-4-(1-hydroxycyclohexyl)butane-1,2-diol |
|---|---|
| PubChem CID | 102425683 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2R)-4-(1-hydroxycyclohexyl)butane-1,2-diol |
| SMILES | OC[C@H](O)CCC1(O)CCCCC1 |
| InChI | InChI=1S/C10H20O3/c11-8-9(12)4-7-10(13)5-2-1-3-6-10/h9,11-13H,1-8H2/t9-/m1/s1 |
| InChIKey | APZGUEZRXDHVOQ-SECBINFHSA-N |
| XLogP | 0.81 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |