C48H49NO7S — CID 102426174
N-benzyl-4-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]benzenesulfonamide (PubChem CID 102426174) has the molecular formula C48H49NO7S and a molecular weight of 783.99 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 102426174 |
| Molecular Formula | C48H49NO7S |
| Molecular Weight | 783.99 g/mol |
| Exact Mass | 783.32 |
| IUPAC Name | N-benzyl-4-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@H]2[C@@H](OCc3ccccc3)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C48H49NO7S/c1-37-27-29-43(30-28-37)57(50,51)49(31-38-17-7-2-8-18-38)45-47(54-34-41-23-13-5-14-24-41)46(53-33-40-21-11-4-12-22-40)44(36-52-32-39-19-9-3-10-20-39)56-48(45)55-35-42-25-15-6-16-26-42/h2-30,44-48H,31-36H2,1H3/t44-,45-,46-,47-,48+/m1/s1 |
| InChIKey | UKSKFEVJXJMYLR-HDOXPOPMSA-N |
| XLogP | 8.88 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.99 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |